C9H18NO5+ — CID 6593882
prop-2-enyl-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]azanium (PubChem CID 6593882) has the molecular formula C9H18NO5+ and a molecular weight of 220.24 g/mol. Its IUPAC name is prop-2-enyl-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]azanium.
| Compound Name | prop-2-enyl-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]azanium |
|---|---|
| PubChem CID | 6593882 |
| Molecular Formula | C9H18NO5+ |
| Molecular Weight | 220.24 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | prop-2-enyl-[(2R,3R,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]azanium |
| SMILES | C=CC[NH2+][C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C9H17NO5/c1-2-3-10-9-8(14)7(13)6(12)5(4-11)15-9/h2,5-14H,1,3-4H2/p+1/t5-,6+,7+,8+,9+/m0/s1 |
| InChIKey | HYHFUUJWYZCDBC-XDQCBXAXSA-O |
| XLogP | -3.46 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.24 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|