C18H15BrClNO — CID 6595617
(3aS,4R,9bS)-9-bromo-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol (PubChem CID 6595617) has the molecular formula C18H15BrClNO and a molecular weight of 376.68 g/mol. Its IUPAC name is (3aS,4R,9bS)-9-bromo-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol.
| Compound Name | (3aS,4R,9bS)-9-bromo-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol |
|---|---|
| PubChem CID | 6595617 |
| Molecular Formula | C18H15BrClNO |
| Molecular Weight | 376.68 g/mol |
| Exact Mass | 375.00 |
| IUPAC Name | (3aS,4R,9bS)-9-bromo-4-(4-chlorophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-6-ol |
| SMILES | Oc1ccc(Br)c2c1N[C@@H](c1ccc(Cl)cc1)[C@H]1CC=C[C@H]21 |
| InChI | InChI=1S/C18H15BrClNO/c19-14-8-9-15(22)18-16(14)12-2-1-3-13(12)17(21-18)10-4-6-11(20)7-5-10/h1-2,4-9,12-13,17,21-22H,3H2/t12-,13-,17-/m0/s1 |
| InChIKey | PCMJPORDPBGSHV-DCGLDWPTSA-N |
| XLogP | 5.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|