C20H18ClNO2 — CID 1417604
1-[(3aR,4R,9bS)-4-(4-chlorophenyl)-6-hydroxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-9-yl]ethanone (PubChem CID 1417604) has the molecular formula C20H18ClNO2 and a molecular weight of 339.82 g/mol. Its IUPAC name is 1-[(3aR,4R,9bS)-4-(4-chlorophenyl)-6-hydroxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-9-yl]ethanone.
| Compound Name | 1-[(3aR,4R,9bS)-4-(4-chlorophenyl)-6-hydroxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-9-yl]ethanone |
|---|---|
| PubChem CID | 1417604 |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 1-[(3aR,4R,9bS)-4-(4-chlorophenyl)-6-hydroxy-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-9-yl]ethanone |
| SMILES | CC(=O)c1ccc(O)c2c1[C@H]1C=CC[C@H]1[C@H](c1ccc(Cl)cc1)N2 |
| InChI | InChI=1S/C20H18ClNO2/c1-11(23)14-9-10-17(24)20-18(14)15-3-2-4-16(15)19(22-20)12-5-7-13(21)8-6-12/h2-3,5-10,15-16,19,22,24H,4H2,1H3/t15-,16+,19-/m0/s1 |
| InChIKey | XNLLUKGSUWZNBI-FCEWJHQRSA-N |
| XLogP | 5.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|