C6H6N4OS — CID 659796
4-amino-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 659796) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 4-amino-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 659796 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 4-amino-3-(furan-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(-c2ccco2)n[nH]c1=S |
| InChI | InChI=1S/C6H6N4OS/c7-10-5(8-9-6(10)12)4-2-1-3-11-4/h1-3H,7H2,(H,9,12) |
| InChIKey | XLYBWYJEEHPZMQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|