C10H11N3O3 — CID 659803
2-hydroxyethyl 2-amino-3-cyano-6-methylpyridine-4-carboxylate (PubChem CID 659803) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2-hydroxyethyl 2-amino-3-cyano-6-methylpyridine-4-carboxylate.
| Compound Name | 2-hydroxyethyl 2-amino-3-cyano-6-methylpyridine-4-carboxylate |
|---|---|
| PubChem CID | 659803 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 2-hydroxyethyl 2-amino-3-cyano-6-methylpyridine-4-carboxylate |
| SMILES | Cc1cc(C(=O)OCCO)c(C#N)c(N)n1 |
| InChI | InChI=1S/C10H11N3O3/c1-6-4-7(10(15)16-3-2-14)8(5-11)9(12)13-6/h4,14H,2-3H2,1H3,(H2,12,13) |
| InChIKey | FEBHONZGXNBALR-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |