C22H25Cl2N3O2 — CID 6599426
2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N'-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]acetohydrazide (PubChem CID 6599426) has the molecular formula C22H25Cl2N3O2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N'-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]acetohydrazide.
| Compound Name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N'-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]acetohydrazide |
|---|---|
| PubChem CID | 6599426 |
| Molecular Formula | C22H25Cl2N3O2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(5,7-dichloro-2-methylquinolin-8-yl)oxy-N'-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl]acetohydrazide |
| SMILES | Cc1ccc2c(Cl)cc(Cl)c(OCC(=O)NNC3=C[C@H]4CC[C@@]3(C)C4(C)C)c2n1 |
| InChI | InChI=1S/C22H25Cl2N3O2/c1-12-5-6-14-15(23)10-16(24)20(19(14)25-12)29-11-18(28)27-26-17-9-13-7-8-22(17,4)21(13,2)3/h5-6,9-10,13,26H,7-8,11H2,1-4H3,(H,27,28)/t13-,22-/m1/s1 |
| InChIKey | UKTDDPCGKPMUTB-MCMMXHMISA-N |
| XLogP | 5.19 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|