C12H21NO2 — CID 66001662
4-(tert-butylamino)-2-(furan-2-yl)butan-2-ol (PubChem CID 66001662) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 4-(tert-butylamino)-2-(furan-2-yl)butan-2-ol.
| Compound Name | 4-(tert-butylamino)-2-(furan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 66001662 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 4-(tert-butylamino)-2-(furan-2-yl)butan-2-ol |
| SMILES | CC(C)(C)NCCC(C)(O)c1ccco1 |
| InChI | InChI=1S/C12H21NO2/c1-11(2,3)13-8-7-12(4,14)10-6-5-9-15-10/h5-6,9,13-14H,7-8H2,1-4H3 |
| InChIKey | ZFHHAKZDUVMWQU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |