C15H18N2O4 — CID 66002723
3-hydroxy-4-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid (PubChem CID 66002723) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-hydroxy-4-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-hydroxy-4-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002723 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-hydroxy-4-[[2-(1H-indol-3-yl)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(O)(CNC(=O)Cc1c[nH]c2ccccc12)CC(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-15(21,7-14(19)20)9-17-13(18)6-10-8-16-12-5-3-2-4-11(10)12/h2-5,8,16,21H,6-7,9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | KJRYMPKVWWCUHO-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |