C11H13F2NO3S — CID 66005031
3,4-difluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide (PubChem CID 66005031) has the molecular formula C11H13F2NO3S and a molecular weight of 277.29 g/mol. Its IUPAC name is 3,4-difluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 66005031 |
| Molecular Formula | C11H13F2NO3S |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 3,4-difluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC(O)C1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H13F2NO3S/c12-10-2-1-9(5-11(10)13)18(16,17)14-6-7-3-8(15)4-7/h1-2,5,7-8,14-15H,3-4,6H2 |
| InChIKey | UNWVFMKPMYUPDC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |