C11H15FN2O3S — CID 82844731
4-amino-3-fluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide (PubChem CID 82844731) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-3-fluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 82844731 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-amino-3-fluoro-N-[(3-hydroxycyclobutyl)methyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCC2CC(O)C2)cc1F |
| InChI | InChI=1S/C11H15FN2O3S/c12-10-5-9(1-2-11(10)13)18(16,17)14-6-7-3-8(15)4-7/h1-2,5,7-8,14-15H,3-4,6,13H2 |
| InChIKey | ZBGSBMGJJABHKI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|