C11H14FN3O3S — CID 82843661
4-amino-3-fluoro-N-[(5-oxopyrrolidin-2-yl)methyl]benzenesulfonamide (PubChem CID 82843661) has the molecular formula C11H14FN3O3S and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-amino-3-fluoro-N-[(5-oxopyrrolidin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-3-fluoro-N-[(5-oxopyrrolidin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 82843661 |
| Molecular Formula | C11H14FN3O3S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-amino-3-fluoro-N-[(5-oxopyrrolidin-2-yl)methyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NCC2CCC(=O)N2)cc1F |
| InChI | InChI=1S/C11H14FN3O3S/c12-9-5-8(2-3-10(9)13)19(17,18)14-6-7-1-4-11(16)15-7/h2-3,5,7,14H,1,4,6,13H2,(H,15,16) |
| InChIKey | ZAWXKYIFJXFAFC-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|