C11H14N2O3S — CID 95968969
N-[[(2R)-5-oxopyrrolidin-2-yl]methyl]benzenesulfonamide (PubChem CID 95968969) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is N-[[(2R)-5-oxopyrrolidin-2-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[(2R)-5-oxopyrrolidin-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95968969 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | N-[[(2R)-5-oxopyrrolidin-2-yl]methyl]benzenesulfonamide |
| SMILES | O=C1CC[C@H](CNS(=O)(=O)c2ccccc2)N1 |
| InChI | InChI=1S/C11H14N2O3S/c14-11-7-6-9(13-11)8-12-17(15,16)10-4-2-1-3-5-10/h1-5,9,12H,6-8H2,(H,13,14)/t9-/m1/s1 |
| InChIKey | KGDGLJPYBBUNBB-SECBINFHSA-N |
| XLogP | 0.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |