C12H14BrNO5S — CID 66006224
4-bromo-3-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoic acid (PubChem CID 66006224) has the molecular formula C12H14BrNO5S and a molecular weight of 364.22 g/mol. Its IUPAC name is 4-bromo-3-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoic acid.
| Compound Name | 4-bromo-3-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 66006224 |
| Molecular Formula | C12H14BrNO5S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 4-bromo-3-[(3-hydroxycyclobutyl)methylsulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(S(=O)(=O)NCC2CC(O)C2)c1 |
| InChI | InChI=1S/C12H14BrNO5S/c13-10-2-1-8(12(16)17)5-11(10)20(18,19)14-6-7-3-9(15)4-7/h1-2,5,7,9,14-15H,3-4,6H2,(H,16,17) |
| InChIKey | LNXWSRDKVGLRSJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |