C16H23N5 — CID 66011298
1-ethyl-3-methyl-5-N-(4-pyrrolidin-1-ylphenyl)pyrazole-4,5-diamine (PubChem CID 66011298) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 1-ethyl-3-methyl-5-N-(4-pyrrolidin-1-ylphenyl)pyrazole-4,5-diamine.
| Compound Name | 1-ethyl-3-methyl-5-N-(4-pyrrolidin-1-ylphenyl)pyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66011298 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1-ethyl-3-methyl-5-N-(4-pyrrolidin-1-ylphenyl)pyrazole-4,5-diamine |
| SMILES | CCn1nc(C)c(N)c1Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C16H23N5/c1-3-21-16(15(17)12(2)19-21)18-13-6-8-14(9-7-13)20-10-4-5-11-20/h6-9,18H,3-5,10-11,17H2,1-2H3 |
| InChIKey | ATVHEFQJJNJIPS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|