C12H20BrN3O2 — CID 66011510
5-(2-bromo-3,3-dimethylbutyl)-1-ethyl-3-methyl-4-nitropyrazole (PubChem CID 66011510) has the molecular formula C12H20BrN3O2 and a molecular weight of 318.22 g/mol. Its IUPAC name is 5-(2-bromo-3,3-dimethylbutyl)-1-ethyl-3-methyl-4-nitropyrazole.
| Compound Name | 5-(2-bromo-3,3-dimethylbutyl)-1-ethyl-3-methyl-4-nitropyrazole |
|---|---|
| PubChem CID | 66011510 |
| Molecular Formula | C12H20BrN3O2 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 5-(2-bromo-3,3-dimethylbutyl)-1-ethyl-3-methyl-4-nitropyrazole |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1CC(Br)C(C)(C)C |
| InChI | InChI=1S/C12H20BrN3O2/c1-6-15-9(7-10(13)12(3,4)5)11(16(17)18)8(2)14-15/h10H,6-7H2,1-5H3 |
| InChIKey | LFLIYUCVMQMVSE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|