C11H19N5O — CID 66015628
3-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]piperidin-2-one (PubChem CID 66015628) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]piperidin-2-one.
| Compound Name | 3-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]piperidin-2-one |
|---|---|
| PubChem CID | 66015628 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-[(4-amino-3-ethyl-1-methylpyrazol-5-yl)amino]piperidin-2-one |
| SMILES | CCc1nn(C)c(NC2CCCNC2=O)c1N |
| InChI | InChI=1S/C11H19N5O/c1-3-7-9(12)10(16(2)15-7)14-8-5-4-6-13-11(8)17/h8,14H,3-6,12H2,1-2H3,(H,13,17) |
| InChIKey | UZPRDMCTYNHYPB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |