C14H17ClN2 — CID 66020556
5-chloro-1-(3,5-dimethylphenyl)-3-ethyl-4-methylpyrazole (PubChem CID 66020556) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 5-chloro-1-(3,5-dimethylphenyl)-3-ethyl-4-methylpyrazole.
| Compound Name | 5-chloro-1-(3,5-dimethylphenyl)-3-ethyl-4-methylpyrazole |
|---|---|
| PubChem CID | 66020556 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 5-chloro-1-(3,5-dimethylphenyl)-3-ethyl-4-methylpyrazole |
| SMILES | CCc1nn(-c2cc(C)cc(C)c2)c(Cl)c1C |
| InChI | InChI=1S/C14H17ClN2/c1-5-13-11(4)14(15)17(16-13)12-7-9(2)6-10(3)8-12/h6-8H,5H2,1-4H3 |
| InChIKey | ASXJWQNOAICILL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |