C12H10Cl3N3O2 — CID 66020734
5-chloro-1-(2,4-dichlorophenyl)-4-nitro-3-propan-2-ylpyrazole (PubChem CID 66020734) has the molecular formula C12H10Cl3N3O2 and a molecular weight of 334.59 g/mol. Its IUPAC name is 5-chloro-1-(2,4-dichlorophenyl)-4-nitro-3-propan-2-ylpyrazole.
| Compound Name | 5-chloro-1-(2,4-dichlorophenyl)-4-nitro-3-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 66020734 |
| Molecular Formula | C12H10Cl3N3O2 |
| Molecular Weight | 334.59 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 5-chloro-1-(2,4-dichlorophenyl)-4-nitro-3-propan-2-ylpyrazole |
| SMILES | CC(C)c1nn(-c2ccc(Cl)cc2Cl)c(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10Cl3N3O2/c1-6(2)10-11(18(19)20)12(15)17(16-10)9-4-3-7(13)5-8(9)14/h3-6H,1-2H3 |
| InChIKey | FPTTZFBESXZTQM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|