C11H5Cl3F2N2O — CID 62879687
5-chloro-1-(2,4-dichlorophenyl)-3-(difluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 62879687) has the molecular formula C11H5Cl3F2N2O and a molecular weight of 325.53 g/mol. Its IUPAC name is 5-chloro-1-(2,4-dichlorophenyl)-3-(difluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 5-chloro-1-(2,4-dichlorophenyl)-3-(difluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 62879687 |
| Molecular Formula | C11H5Cl3F2N2O |
| Molecular Weight | 325.53 g/mol |
| Exact Mass | 323.94 |
| IUPAC Name | 5-chloro-1-(2,4-dichlorophenyl)-3-(difluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1c(C(F)F)nn(-c2ccc(Cl)cc2Cl)c1Cl |
| InChI | InChI=1S/C11H5Cl3F2N2O/c12-5-1-2-8(7(13)3-5)18-10(14)6(4-19)9(17-18)11(15)16/h1-4,11H |
| InChIKey | GIKWOJFGUIQNKP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|