C10H5ClF2N6O — CID 62881906
5-chloro-3-(difluoromethyl)-1-(7H-purin-6-yl)pyrazole-4-carbaldehyde (PubChem CID 62881906) has the molecular formula C10H5ClF2N6O and a molecular weight of 298.64 g/mol. Its IUPAC name is 5-chloro-3-(difluoromethyl)-1-(7H-purin-6-yl)pyrazole-4-carbaldehyde.
| Compound Name | 5-chloro-3-(difluoromethyl)-1-(7H-purin-6-yl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 62881906 |
| Molecular Formula | C10H5ClF2N6O |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 5-chloro-3-(difluoromethyl)-1-(7H-purin-6-yl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1c(C(F)F)nn(-c2ncnc3nc[nH]c23)c1Cl |
| InChI | InChI=1S/C10H5ClF2N6O/c11-7-4(1-20)5(8(12)13)18-19(7)10-6-9(15-2-14-6)16-3-17-10/h1-3,8H,(H,14,15,16,17) |
| InChIKey | UMVWLGUNGBATTN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|