About 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole
3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole (PubChem CID 83193286) has the molecular formula C11H7Cl3N2S
and a molecular weight of 305.62 g/mol. Its IUPAC name is 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole.
Molecular Properties
| Compound Name | 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole |
| PubChem CID | 83193286 |
| Molecular Formula | C11H7Cl3N2S |
| Molecular Weight | 305.62 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole |
| SMILES | Clc1ccc(-n2nc3c(c2Cl)CSC3)c(Cl)c1 |
| InChI | InChI=1S/C11H7Cl3N2S/c12-6-1-2-10(8(13)3-6)16-11(14)7-4-17-5-9(7)15-16/h1-3H,4-5H2 |
| InChIKey | VVUWSNNWSOZGCZ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole?
The IUPAC name of 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole (CID 83193286) is 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole.
What is the SMILES notation for 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole?
The canonical SMILES for 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole is Clc1ccc(-n2nc3c(c2Cl)CSC3)c(Cl)c1.
What is the InChIKey of 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole?
The InChIKey is VVUWSNNWSOZGCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl3N2S/c12-6-1-2-10(8(13)3-6)16-11(14)7-4-17-5-9(7)15-16/h1-3H,4-5H2.
What are the key properties of 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole?
3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole has a molecular weight of 305.62 g/mol, XLogP of 4.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-(2,4-dichlorophenyl)-4,6-dihydrothieno[3,4-c]pyrazole is sourced from PubChem (CID 83193286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).