C13H11Cl3N2 — CID 66022173
3-chloro-2-(3,4-dichlorophenyl)-4,5,6,7-tetrahydroindazole (PubChem CID 66022173) has the molecular formula C13H11Cl3N2 and a molecular weight of 301.60 g/mol. Its IUPAC name is 3-chloro-2-(3,4-dichlorophenyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-chloro-2-(3,4-dichlorophenyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 66022173 |
| Molecular Formula | C13H11Cl3N2 |
| Molecular Weight | 301.60 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3-chloro-2-(3,4-dichlorophenyl)-4,5,6,7-tetrahydroindazole |
| SMILES | Clc1ccc(-n2nc3c(c2Cl)CCCC3)cc1Cl |
| InChI | InChI=1S/C13H11Cl3N2/c14-10-6-5-8(7-11(10)15)18-13(16)9-3-1-2-4-12(9)17-18/h5-7H,1-4H2 |
| InChIKey | CMGHMNXVHBISLZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |