C12H20N2O — CID 66022942
2-cycloheptyl-4,5-dimethyl-1H-pyrazol-3-one (PubChem CID 66022942) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-cycloheptyl-4,5-dimethyl-1H-pyrazol-3-one.
| Compound Name | 2-cycloheptyl-4,5-dimethyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 66022942 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-cycloheptyl-4,5-dimethyl-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(C2CCCCCC2)c(=O)c1C |
| InChI | InChI=1S/C12H20N2O/c1-9-10(2)13-14(12(9)15)11-7-5-3-4-6-8-11/h11,13H,3-8H2,1-2H3 |
| InChIKey | IITVFYAPXWXLPZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |