C13H23N5O2 — CID 66027950
2,2-dimethyl-1-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)piperazine (PubChem CID 66027950) has the molecular formula C13H23N5O2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)piperazine.
| Compound Name | 2,2-dimethyl-1-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)piperazine |
|---|---|
| PubChem CID | 66027950 |
| Molecular Formula | C13H23N5O2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 2,2-dimethyl-1-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)piperazine |
| SMILES | Cc1nn(C(C)C)c(N2CCNCC2(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H23N5O2/c1-9(2)17-12(11(18(19)20)10(3)15-17)16-7-6-14-8-13(16,4)5/h9,14H,6-8H2,1-5H3 |
| InChIKey | GIHNDZMDQGVUNT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|