C12H21N5O2 — CID 66015236
1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2,2-dimethylpiperazine (PubChem CID 66015236) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2,2-dimethylpiperazine.
| Compound Name | 1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 66015236 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 1-(3-ethyl-1-methyl-4-nitropyrazol-5-yl)-2,2-dimethylpiperazine |
| SMILES | CCc1nn(C)c(N2CCNCC2(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H21N5O2/c1-5-9-10(17(18)19)11(15(4)14-9)16-7-6-13-8-12(16,2)3/h13H,5-8H2,1-4H3 |
| InChIKey | CHGGIEDFPLNQNI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|