C13H16Cl2N4 — CID 66027996
5-N-(2,3-dichlorophenyl)-3-methyl-1-propylpyrazole-4,5-diamine (PubChem CID 66027996) has the molecular formula C13H16Cl2N4 and a molecular weight of 299.20 g/mol. Its IUPAC name is 5-N-(2,3-dichlorophenyl)-3-methyl-1-propylpyrazole-4,5-diamine.
| Compound Name | 5-N-(2,3-dichlorophenyl)-3-methyl-1-propylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 66027996 |
| Molecular Formula | C13H16Cl2N4 |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-N-(2,3-dichlorophenyl)-3-methyl-1-propylpyrazole-4,5-diamine |
| SMILES | CCCn1nc(C)c(N)c1Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2N4/c1-3-7-19-13(12(16)8(2)18-19)17-10-6-4-5-9(14)11(10)15/h4-6,17H,3,7,16H2,1-2H3 |
| InChIKey | UTBNIWKNUVNUFG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |