C9H16N4O4S2 — CID 66029124
2-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)sulfanylethanesulfonamide (PubChem CID 66029124) has the molecular formula C9H16N4O4S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)sulfanylethanesulfonamide.
| Compound Name | 2-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)sulfanylethanesulfonamide |
|---|---|
| PubChem CID | 66029124 |
| Molecular Formula | C9H16N4O4S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-(3-methyl-4-nitro-1-propan-2-ylpyrazol-5-yl)sulfanylethanesulfonamide |
| SMILES | Cc1nn(C(C)C)c(SCCS(N)(=O)=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N4O4S2/c1-6(2)12-9(18-4-5-19(10,16)17)8(13(14)15)7(3)11-12/h6H,4-5H2,1-3H3,(H2,10,16,17) |
| InChIKey | XHACPHXYVAVUHJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|