C6H10N4O4S2 — CID 103080488
2-(1-methyl-4-nitropyrazol-3-yl)sulfanylethanesulfonamide (PubChem CID 103080488) has the molecular formula C6H10N4O4S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-(1-methyl-4-nitropyrazol-3-yl)sulfanylethanesulfonamide.
| Compound Name | 2-(1-methyl-4-nitropyrazol-3-yl)sulfanylethanesulfonamide |
|---|---|
| PubChem CID | 103080488 |
| Molecular Formula | C6H10N4O4S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-(1-methyl-4-nitropyrazol-3-yl)sulfanylethanesulfonamide |
| SMILES | Cn1cc([N+](=O)[O-])c(SCCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C6H10N4O4S2/c1-9-4-5(10(11)12)6(8-9)15-2-3-16(7,13)14/h4H,2-3H2,1H3,(H2,7,13,14) |
| InChIKey | JXEQYRURTLQSLR-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|