C6H10N4O6S2 — CID 103080489
2-(1-methyl-4-nitropyrazol-3-yl)sulfonylethanesulfonamide (PubChem CID 103080489) has the molecular formula C6H10N4O6S2 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(1-methyl-4-nitropyrazol-3-yl)sulfonylethanesulfonamide.
| Compound Name | 2-(1-methyl-4-nitropyrazol-3-yl)sulfonylethanesulfonamide |
|---|---|
| PubChem CID | 103080489 |
| Molecular Formula | C6H10N4O6S2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | 2-(1-methyl-4-nitropyrazol-3-yl)sulfonylethanesulfonamide |
| SMILES | Cn1cc([N+](=O)[O-])c(S(=O)(=O)CCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C6H10N4O6S2/c1-9-4-5(10(11)12)6(8-9)17(13,14)2-3-18(7,15)16/h4H,2-3H2,1H3,(H2,7,15,16) |
| InChIKey | NTRIOHMSLKMMIT-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 155.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|