C9H12N2O6S2 — CID 113334102
2-(2-methyl-6-nitrophenyl)sulfonylethanesulfonamide (PubChem CID 113334102) has the molecular formula C9H12N2O6S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(2-methyl-6-nitrophenyl)sulfonylethanesulfonamide.
| Compound Name | 2-(2-methyl-6-nitrophenyl)sulfonylethanesulfonamide |
|---|---|
| PubChem CID | 113334102 |
| Molecular Formula | C9H12N2O6S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 2-(2-methyl-6-nitrophenyl)sulfonylethanesulfonamide |
| SMILES | Cc1cccc([N+](=O)[O-])c1S(=O)(=O)CCS(N)(=O)=O |
| InChI | InChI=1S/C9H12N2O6S2/c1-7-3-2-4-8(11(12)13)9(7)18(14,15)5-6-19(10,16)17/h2-4H,5-6H2,1H3,(H2,10,16,17) |
| InChIKey | AIHSILAWINYFDY-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|