C8H11N3O6S2 — CID 81136768
2-[(6-methyl-3-nitro-2-pyridinyl)sulfonyl]ethanesulfonamide (PubChem CID 81136768) has the molecular formula C8H11N3O6S2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-[(6-methyl-3-nitro-2-pyridinyl)sulfonyl]ethanesulfonamide.
| Compound Name | 2-[(6-methyl-3-nitro-2-pyridinyl)sulfonyl]ethanesulfonamide |
|---|---|
| PubChem CID | 81136768 |
| Molecular Formula | C8H11N3O6S2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | 2-[(6-methyl-3-nitro-2-pyridinyl)sulfonyl]ethanesulfonamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(S(=O)(=O)CCS(N)(=O)=O)n1 |
| InChI | InChI=1S/C8H11N3O6S2/c1-6-2-3-7(11(12)13)8(10-6)18(14,15)4-5-19(9,16)17/h2-3H,4-5H2,1H3,(H2,9,16,17) |
| InChIKey | FCFWVQVPBAHACM-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 150.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|