C8H8N4O4S2 — CID 103473164
2-[(5-cyano-3-nitro-2-pyridinyl)sulfanyl]ethanesulfonamide (PubChem CID 103473164) has the molecular formula C8H8N4O4S2 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[(5-cyano-3-nitro-2-pyridinyl)sulfanyl]ethanesulfonamide.
| Compound Name | 2-[(5-cyano-3-nitro-2-pyridinyl)sulfanyl]ethanesulfonamide |
|---|---|
| PubChem CID | 103473164 |
| Molecular Formula | C8H8N4O4S2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-[(5-cyano-3-nitro-2-pyridinyl)sulfanyl]ethanesulfonamide |
| SMILES | N#Cc1cnc(SCCS(N)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H8N4O4S2/c9-4-6-3-7(12(13)14)8(11-5-6)17-1-2-18(10,15)16/h3,5H,1-2H2,(H2,10,15,16) |
| InChIKey | QNBCRLNIFYJIIJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|