C20H36ClN3O — CID 6603138
N-[2-(cyclohexen-1-yl)ethyl]-2-(4-cyclohexylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 6603138) has the molecular formula C20H36ClN3O and a molecular weight of 369.98 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-(4-cyclohexylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-cyclohexylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 6603138 |
| Molecular Formula | C20H36ClN3O |
| Molecular Weight | 369.98 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-(4-cyclohexylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CN1CCN(C2CCCCC2)CC1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H35N3O.ClH/c24-20(21-12-11-18-7-3-1-4-8-18)17-22-13-15-23(16-14-22)19-9-5-2-6-10-19;/h7,19H,1-6,8-17H2,(H,21,24);1H |
| InChIKey | SQGPXUCYCDPGLC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.98 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|