C16H26N2O2 — CID 2916009
N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclohexyloxamide (PubChem CID 2916009) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclohexyloxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclohexyloxamide |
|---|---|
| PubChem CID | 2916009 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-cyclohexyloxamide |
| SMILES | O=C(NCCC1=CCCCC1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C16H26N2O2/c19-15(16(20)18-14-9-5-2-6-10-14)17-12-11-13-7-3-1-4-8-13/h7,14H,1-6,8-12H2,(H,17,19)(H,18,20) |
| InChIKey | YPVYKSUNMWYSOT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|