C15H26N2O2 — CID 2291103
N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-methylbutyl)oxamide (PubChem CID 2291103) has the molecular formula C15H26N2O2 and a molecular weight of 266.38 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-methylbutyl)oxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-methylbutyl)oxamide |
|---|---|
| PubChem CID | 2291103 |
| Molecular Formula | C15H26N2O2 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-N'-(3-methylbutyl)oxamide |
| SMILES | CC(C)CCNC(=O)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H26N2O2/c1-12(2)8-10-16-14(18)15(19)17-11-9-13-6-4-3-5-7-13/h6,12H,3-5,7-11H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | MRMDFARSQXFMSM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|