C16H24N2O2 — CID 167714471
N'-cyclobutyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]oxamide (PubChem CID 167714471) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N'-cyclobutyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]oxamide.
| Compound Name | N'-cyclobutyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]oxamide |
|---|---|
| PubChem CID | 167714471 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-cyclobutyl-N-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]oxamide |
| SMILES | C=C(C)[C@@H]1CC=C(CNC(=O)C(=O)NC2CCC2)CC1 |
| InChI | InChI=1S/C16H24N2O2/c1-11(2)13-8-6-12(7-9-13)10-17-15(19)16(20)18-14-4-3-5-14/h6,13-14H,1,3-5,7-10H2,2H3,(H,17,19)(H,18,20)/t13-/m1/s1 |
| InChIKey | LHCILNPUBFDEMQ-CYBMUJFWSA-N |
| XLogP | 2.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|