C12H19NO — CID 14993078
N-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)acetamide (PubChem CID 14993078) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is N-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)acetamide.
| Compound Name | N-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)acetamide |
|---|---|
| PubChem CID | 14993078 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)acetamide |
| SMILES | C=C(C)C1CC=C(C)C(NC(C)=O)C1 |
| InChI | InChI=1S/C12H19NO/c1-8(2)11-6-5-9(3)12(7-11)13-10(4)14/h5,11-12H,1,6-7H2,2-4H3,(H,13,14) |
| InChIKey | GLOVOGSNFFJSQI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|