C16H22Cl2N2O3 — CID 6603510
ethyl 4-[3-(4-chlorophenyl)-3-oxopropyl]piperazine-1-carboxylate;hydrochloride (PubChem CID 6603510) has the molecular formula C16H22Cl2N2O3 and a molecular weight of 361.27 g/mol. Its IUPAC name is ethyl 4-[3-(4-chlorophenyl)-3-oxopropyl]piperazine-1-carboxylate;hydrochloride.
| Compound Name | ethyl 4-[3-(4-chlorophenyl)-3-oxopropyl]piperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 6603510 |
| Molecular Formula | C16H22Cl2N2O3 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | ethyl 4-[3-(4-chlorophenyl)-3-oxopropyl]piperazine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)N1CCN(CCC(=O)c2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C16H21ClN2O3.ClH/c1-2-22-16(21)19-11-9-18(10-12-19)8-7-15(20)13-3-5-14(17)6-4-13;/h3-6H,2,7-12H2,1H3;1H |
| InChIKey | DJTIOBOAXGNRQB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |