C13H24BrN3O2 — CID 66038256
1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-3-(2-methoxyethylamino)-2-methylpropan-2-ol (PubChem CID 66038256) has the molecular formula C13H24BrN3O2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-3-(2-methoxyethylamino)-2-methylpropan-2-ol.
| Compound Name | 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-3-(2-methoxyethylamino)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 66038256 |
| Molecular Formula | C13H24BrN3O2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-(4-bromo-3-ethyl-1-methylpyrazol-5-yl)-3-(2-methoxyethylamino)-2-methylpropan-2-ol |
| SMILES | CCc1nn(C)c(CC(C)(O)CNCCOC)c1Br |
| InChI | InChI=1S/C13H24BrN3O2/c1-5-10-12(14)11(17(3)16-10)8-13(2,18)9-15-6-7-19-4/h15,18H,5-9H2,1-4H3 |
| InChIKey | BMVTYEQSZLJKNF-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|