C12H18BrClN2 — CID 102642045
4-bromo-5-[2-(chloromethyl)-2-methylbut-3-enyl]-3-ethyl-1-methylpyrazole (PubChem CID 102642045) has the molecular formula C12H18BrClN2 and a molecular weight of 305.65 g/mol. Its IUPAC name is 4-bromo-5-[2-(chloromethyl)-2-methylbut-3-enyl]-3-ethyl-1-methylpyrazole.
| Compound Name | 4-bromo-5-[2-(chloromethyl)-2-methylbut-3-enyl]-3-ethyl-1-methylpyrazole |
|---|---|
| PubChem CID | 102642045 |
| Molecular Formula | C12H18BrClN2 |
| Molecular Weight | 305.65 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-bromo-5-[2-(chloromethyl)-2-methylbut-3-enyl]-3-ethyl-1-methylpyrazole |
| SMILES | C=CC(C)(CCl)Cc1c(Br)c(CC)nn1C |
| InChI | InChI=1S/C12H18BrClN2/c1-5-9-11(13)10(16(4)15-9)7-12(3,6-2)8-14/h6H,2,5,7-8H2,1,3-4H3 |
| InChIKey | NPTQAEWWOOJSEW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|