C12H23NO2 — CID 66038532
1-(1,4-dioxan-2-yl)-N-ethyl-3-methylidenepentan-1-amine (PubChem CID 66038532) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-yl)-N-ethyl-3-methylidenepentan-1-amine.
| Compound Name | 1-(1,4-dioxan-2-yl)-N-ethyl-3-methylidenepentan-1-amine |
|---|---|
| PubChem CID | 66038532 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-(1,4-dioxan-2-yl)-N-ethyl-3-methylidenepentan-1-amine |
| SMILES | C=C(CC)CC(NCC)C1COCCO1 |
| InChI | InChI=1S/C12H23NO2/c1-4-10(3)8-11(13-5-2)12-9-14-6-7-15-12/h11-13H,3-9H2,1-2H3 |
| InChIKey | QUKPBYSRKLJUDI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|