C10H21NO2 — CID 66038780
1-methoxy-3-[methyl(2-methylidenebutyl)amino]propan-2-ol (PubChem CID 66038780) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is 1-methoxy-3-[methyl(2-methylidenebutyl)amino]propan-2-ol.
| Compound Name | 1-methoxy-3-[methyl(2-methylidenebutyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 66038780 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 1-methoxy-3-[methyl(2-methylidenebutyl)amino]propan-2-ol |
| SMILES | C=C(CC)CN(C)CC(O)COC |
| InChI | InChI=1S/C10H21NO2/c1-5-9(2)6-11(3)7-10(12)8-13-4/h10,12H,2,5-8H2,1,3-4H3 |
| InChIKey | ZUSJRDLNRMIIPL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|