3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid

C13H16N4O4 — CID 66044352

IUPAC3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid
SMILESCOc1cccc(OC)c1-c1nnnn1C(C)CC(=O)O
InChIInChI=1S/C13H16N4O4/c1-8(7-11(18)19)17-13(14-15-16-17)12-9(20-2)5-4-6-10(12)21-3/h4-6,8H,7H2,1-3H3,(H,18,19)
InChIKeyOVWIWSATDZYXSS-UHFFFAOYSA-N
MW292.30 g/mol
LogP1.39
Rot. Bonds6

About 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid

3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid (PubChem CID 66044352) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid.

Molecular Properties

Compound Name3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid
PubChem CID66044352
Molecular FormulaC13H16N4O4
Molecular Weight292.30 g/mol
Exact Mass292.12
IUPAC Name3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid
SMILESCOc1cccc(OC)c1-c1nnnn1C(C)CC(=O)O
InChIInChI=1S/C13H16N4O4/c1-8(7-11(18)19)17-13(14-15-16-17)12-9(20-2)5-4-6-10(12)21-3/h4-6,8H,7H2,1-3H3,(H,18,19)
InChIKeyOVWIWSATDZYXSS-UHFFFAOYSA-N
XLogP1.39
TPSA99.36 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.30
LogP ≤ 51.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid?
The IUPAC name of 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid (CID 66044352) is 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid.
What is the SMILES notation for 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid?
The canonical SMILES for 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid is COc1cccc(OC)c1-c1nnnn1C(C)CC(=O)O.
What is the InChIKey of 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid?
The InChIKey is OVWIWSATDZYXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O4/c1-8(7-11(18)19)17-13(14-15-16-17)12-9(20-2)5-4-6-10(12)21-3/h4-6,8H,7H2,1-3H3,(H,18,19).
What are the key properties of 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid?
3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid has a molecular weight of 292.30 g/mol, XLogP of 1.39, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(2,6-dimethoxyphenyl)tetrazol-1-yl]butanoic acid is sourced from PubChem (CID 66044352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).