C13H16N4O4 — CID 66042629
3-[5-(3,4-dimethoxyphenyl)tetrazol-1-yl]butanoic acid (PubChem CID 66042629) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-[5-(3,4-dimethoxyphenyl)tetrazol-1-yl]butanoic acid.
| Compound Name | 3-[5-(3,4-dimethoxyphenyl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 66042629 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[5-(3,4-dimethoxyphenyl)tetrazol-1-yl]butanoic acid |
| SMILES | COc1ccc(-c2nnnn2C(C)CC(=O)O)cc1OC |
| InChI | InChI=1S/C13H16N4O4/c1-8(6-12(18)19)17-13(14-15-16-17)9-4-5-10(20-2)11(7-9)21-3/h4-5,7-8H,6H2,1-3H3,(H,18,19) |
| InChIKey | RFWSHKARBADNIA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |