C13H16N4O5 — CID 54345783
2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]propanoic acid (PubChem CID 54345783) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]propanoic acid.
| Compound Name | 2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 54345783 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]propanoic acid |
| SMILES | COc1cc(-c2nnnn2C(C)C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C13H16N4O5/c1-7(13(18)19)17-12(14-15-16-17)8-5-9(20-2)11(22-4)10(6-8)21-3/h5-7H,1-4H3,(H,18,19) |
| InChIKey | UCFKOAFUUJPBJW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |