C12H17N5O3 — CID 83558388
2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]ethanamine (PubChem CID 83558388) has the molecular formula C12H17N5O3 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]ethanamine.
| Compound Name | 2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 83558388 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-[5-(3,4,5-trimethoxyphenyl)tetrazol-1-yl]ethanamine |
| SMILES | COc1cc(-c2nnnn2CCN)cc(OC)c1OC |
| InChI | InChI=1S/C12H17N5O3/c1-18-9-6-8(7-10(19-2)11(9)20-3)12-14-15-16-17(12)5-4-13/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | XSUSJWDXFQWDIT-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |