C13H12N4O3 — CID 66041230
3-[5-(1-benzofuran-2-yl)tetrazol-1-yl]butanoic acid (PubChem CID 66041230) has the molecular formula C13H12N4O3 and a molecular weight of 272.26 g/mol. Its IUPAC name is 3-[5-(1-benzofuran-2-yl)tetrazol-1-yl]butanoic acid.
| Compound Name | 3-[5-(1-benzofuran-2-yl)tetrazol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 66041230 |
| Molecular Formula | C13H12N4O3 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-[5-(1-benzofuran-2-yl)tetrazol-1-yl]butanoic acid |
| SMILES | CC(CC(=O)O)n1nnnc1-c1cc2ccccc2o1 |
| InChI | InChI=1S/C13H12N4O3/c1-8(6-12(18)19)17-13(14-15-16-17)11-7-9-4-2-3-5-10(9)20-11/h2-5,7-8H,6H2,1H3,(H,18,19) |
| InChIKey | SLVKLZIBOHAMFZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |