C13H14ClFN4O2 — CID 107995375
3-[5-(4-chloro-3-fluorophenyl)tetrazol-1-yl]-4-methylpentanoic acid (PubChem CID 107995375) has the molecular formula C13H14ClFN4O2 and a molecular weight of 312.73 g/mol. Its IUPAC name is 3-[5-(4-chloro-3-fluorophenyl)tetrazol-1-yl]-4-methylpentanoic acid.
| Compound Name | 3-[5-(4-chloro-3-fluorophenyl)tetrazol-1-yl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 107995375 |
| Molecular Formula | C13H14ClFN4O2 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-[5-(4-chloro-3-fluorophenyl)tetrazol-1-yl]-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)n1nnnc1-c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C13H14ClFN4O2/c1-7(2)11(6-12(20)21)19-13(16-17-18-19)8-3-4-9(14)10(15)5-8/h3-5,7,11H,6H2,1-2H3,(H,20,21) |
| InChIKey | GJSJGEXXYHQSRM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |