C12H12BrFN4O2 — CID 81071526
4-[5-(4-bromo-3-fluorophenyl)tetrazol-1-yl]-3-methylbutanoic acid (PubChem CID 81071526) has the molecular formula C12H12BrFN4O2 and a molecular weight of 343.16 g/mol. Its IUPAC name is 4-[5-(4-bromo-3-fluorophenyl)tetrazol-1-yl]-3-methylbutanoic acid.
| Compound Name | 4-[5-(4-bromo-3-fluorophenyl)tetrazol-1-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 81071526 |
| Molecular Formula | C12H12BrFN4O2 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 4-[5-(4-bromo-3-fluorophenyl)tetrazol-1-yl]-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)Cn1nnnc1-c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H12BrFN4O2/c1-7(4-11(19)20)6-18-12(15-16-17-18)8-2-3-9(13)10(14)5-8/h2-3,5,7H,4,6H2,1H3,(H,19,20) |
| InChIKey | CJBDFXKZFFBFRY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |