C12H12ClFN4O3 — CID 103160390
4-[5-(3-chloro-4-fluorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid (PubChem CID 103160390) has the molecular formula C12H12ClFN4O3 and a molecular weight of 314.70 g/mol. Its IUPAC name is 4-[5-(3-chloro-4-fluorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid.
| Compound Name | 4-[5-(3-chloro-4-fluorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103160390 |
| Molecular Formula | C12H12ClFN4O3 |
| Molecular Weight | 314.70 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-[5-(3-chloro-4-fluorophenyl)tetrazol-1-yl]-3-methoxybutanoic acid |
| SMILES | COC(CC(=O)O)Cn1nnnc1-c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClFN4O3/c1-21-8(5-11(19)20)6-18-12(15-16-17-18)7-2-3-10(14)9(13)4-7/h2-4,8H,5-6H2,1H3,(H,19,20) |
| InChIKey | RYQLGTMWVORSIB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.70 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |